About N-(2-ethoxyethyl)-2,2-difluoroethanamine
N-(2-ethoxyethyl)-2,2-difluoroethanamine (PubChem CID 60921493) has the molecular formula C6H13F2NO
and a molecular weight of 153.17 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | N-(2-ethoxyethyl)-2,2-difluoroethanamine |
| PubChem CID | 60921493 |
| Molecular Formula | C6H13F2NO |
| Molecular Weight | 153.17 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | N-(2-ethoxyethyl)-2,2-difluoroethanamine |
| SMILES | CCOCCNCC(F)F |
| InChI | InChI=1S/C6H13F2NO/c1-2-10-4-3-9-5-6(7)8/h6,9H,2-5H2,1H3 |
| InChIKey | GWXAJVSYOBGGBV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.17 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethoxyethyl)-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethoxyethyl)-2,2-difluoroethanamine?
The IUPAC name of N-(2-ethoxyethyl)-2,2-difluoroethanamine (CID 60921493) is N-(2-ethoxyethyl)-2,2-difluoroethanamine.
What is the SMILES notation for N-(2-ethoxyethyl)-2,2-difluoroethanamine?
The canonical SMILES for N-(2-ethoxyethyl)-2,2-difluoroethanamine is CCOCCNCC(F)F.
What is the InChIKey of N-(2-ethoxyethyl)-2,2-difluoroethanamine?
The InChIKey is GWXAJVSYOBGGBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F2NO/c1-2-10-4-3-9-5-6(7)8/h6,9H,2-5H2,1H3.
What are the key properties of N-(2-ethoxyethyl)-2,2-difluoroethanamine?
N-(2-ethoxyethyl)-2,2-difluoroethanamine has a molecular weight of 153.17 g/mol, XLogP of 0.88, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethoxyethyl)-2,2-difluoroethanamine is sourced from PubChem (CID 60921493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).