C12H17F2NO — CID 60921749
1-[4-(2,2-difluoroethoxy)phenyl]-N-ethylethanamine (PubChem CID 60921749) has the molecular formula C12H17F2NO and a molecular weight of 229.27 g/mol. Its IUPAC name is 1-[4-(2,2-difluoroethoxy)phenyl]-N-ethylethanamine.
| Compound Name | 1-[4-(2,2-difluoroethoxy)phenyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 60921749 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 1-[4-(2,2-difluoroethoxy)phenyl]-N-ethylethanamine |
| SMILES | CCNC(C)c1ccc(OCC(F)F)cc1 |
| InChI | InChI=1S/C12H17F2NO/c1-3-15-9(2)10-4-6-11(7-5-10)16-8-12(13)14/h4-7,9,12,15H,3,8H2,1-2H3 |
| InChIKey | QWAXCFQLEPFAAB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |