About 3-[2,2-difluoroethyl(methyl)amino]propanimidamide
3-[2,2-difluoroethyl(methyl)amino]propanimidamide (PubChem CID 60921772) has the molecular formula C6H13F2N3
and a molecular weight of 165.19 g/mol. Its IUPAC name is 3-[2,2-difluoroethyl(methyl)amino]propanimidamide.
Molecular Properties
| Compound Name | 3-[2,2-difluoroethyl(methyl)amino]propanimidamide |
| PubChem CID | 60921772 |
| Molecular Formula | C6H13F2N3 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.11 |
| IUPAC Name | 3-[2,2-difluoroethyl(methyl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(C)CC(F)F |
| InChI | InChI=1S/C6H13F2N3/c1-11(4-5(7)8)3-2-6(9)10/h5H,2-4H2,1H3,(H3,9,10) |
| InChIKey | WYLVYDHZVCYWCU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,2-difluoroethyl(methyl)amino]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,2-difluoroethyl(methyl)amino]propanimidamide?
The IUPAC name of 3-[2,2-difluoroethyl(methyl)amino]propanimidamide (CID 60921772) is 3-[2,2-difluoroethyl(methyl)amino]propanimidamide.
What is the SMILES notation for 3-[2,2-difluoroethyl(methyl)amino]propanimidamide?
The canonical SMILES for 3-[2,2-difluoroethyl(methyl)amino]propanimidamide is [H]/N=C(\N)CCN(C)CC(F)F.
What is the InChIKey of 3-[2,2-difluoroethyl(methyl)amino]propanimidamide?
The InChIKey is WYLVYDHZVCYWCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F2N3/c1-11(4-5(7)8)3-2-6(9)10/h5H,2-4H2,1H3,(H3,9,10).
What are the key properties of 3-[2,2-difluoroethyl(methyl)amino]propanimidamide?
3-[2,2-difluoroethyl(methyl)amino]propanimidamide has a molecular weight of 165.19 g/mol, XLogP of 0.51, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,2-difluoroethyl(methyl)amino]propanimidamide is sourced from PubChem (CID 60921772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).