About 6-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]pyridin-3-amine
6-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]pyridin-3-amine (PubChem CID 60922049) has the molecular formula C15H20N6
and a molecular weight of 284.37 g/mol. Its IUPAC name is 6-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]pyridin-3-amine |
| PubChem CID | 60922049 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 6-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]pyridin-3-amine |
| SMILES | Cc1cc(N2CCN(c3ccc(N)cn3)CC2)nc(C)n1 |
| InChI | InChI=1S/C15H20N6/c1-11-9-15(19-12(2)18-11)21-7-5-20(6-8-21)14-4-3-13(16)10-17-14/h3-4,9-10H,5-8,16H2,1-2H3 |
| InChIKey | WLMIXGNCURHEAL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]pyridin-3-amine?
The IUPAC name of 6-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]pyridin-3-amine (CID 60922049) is 6-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]pyridin-3-amine.
What is the SMILES notation for 6-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]pyridin-3-amine?
The canonical SMILES for 6-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]pyridin-3-amine is Cc1cc(N2CCN(c3ccc(N)cn3)CC2)nc(C)n1.
What is the InChIKey of 6-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]pyridin-3-amine?
The InChIKey is WLMIXGNCURHEAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N6/c1-11-9-15(19-12(2)18-11)21-7-5-20(6-8-21)14-4-3-13(16)10-17-14/h3-4,9-10H,5-8,16H2,1-2H3.
What are the key properties of 6-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]pyridin-3-amine?
6-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]pyridin-3-amine has a molecular weight of 284.37 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]pyridin-3-amine is sourced from PubChem (CID 60922049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).