C12H17F2N — CID 60922267
4-tert-butyl-N-(2,2-difluoroethyl)aniline (PubChem CID 60922267) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is 4-tert-butyl-N-(2,2-difluoroethyl)aniline.
| Compound Name | 4-tert-butyl-N-(2,2-difluoroethyl)aniline |
|---|---|
| PubChem CID | 60922267 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 4-tert-butyl-N-(2,2-difluoroethyl)aniline |
| SMILES | CC(C)(C)c1ccc(NCC(F)F)cc1 |
| InChI | InChI=1S/C12H17F2N/c1-12(2,3)9-4-6-10(7-5-9)15-8-11(13)14/h4-7,11,15H,8H2,1-3H3 |
| InChIKey | VUJXFESUJUYKGZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |