About 2-bromo-N-(2,2-difluoroethyl)aniline
2-bromo-N-(2,2-difluoroethyl)aniline (PubChem CID 60922388) has the molecular formula C8H8BrF2N
and a molecular weight of 236.06 g/mol. Its IUPAC name is 2-bromo-N-(2,2-difluoroethyl)aniline.
Molecular Properties
| Compound Name | 2-bromo-N-(2,2-difluoroethyl)aniline |
| PubChem CID | 60922388 |
| Molecular Formula | C8H8BrF2N |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | 2-bromo-N-(2,2-difluoroethyl)aniline |
| SMILES | FC(F)CNc1ccccc1Br |
| InChI | InChI=1S/C8H8BrF2N/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4,8,12H,5H2 |
| InChIKey | RBGNCLIZRFMHDD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-N-(2,2-difluoroethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-(2,2-difluoroethyl)aniline?
The IUPAC name of 2-bromo-N-(2,2-difluoroethyl)aniline (CID 60922388) is 2-bromo-N-(2,2-difluoroethyl)aniline.
What is the SMILES notation for 2-bromo-N-(2,2-difluoroethyl)aniline?
The canonical SMILES for 2-bromo-N-(2,2-difluoroethyl)aniline is FC(F)CNc1ccccc1Br.
What is the InChIKey of 2-bromo-N-(2,2-difluoroethyl)aniline?
The InChIKey is RBGNCLIZRFMHDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrF2N/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4,8,12H,5H2.
What are the key properties of 2-bromo-N-(2,2-difluoroethyl)aniline?
2-bromo-N-(2,2-difluoroethyl)aniline has a molecular weight of 236.06 g/mol, XLogP of 3.13, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-(2,2-difluoroethyl)aniline is sourced from PubChem (CID 60922388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).