C10H10F2O3 — CID 60922402
2-(2,2-difluoroethoxy)-5-methoxybenzaldehyde (PubChem CID 60922402) has the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-5-methoxybenzaldehyde.
| Compound Name | 2-(2,2-difluoroethoxy)-5-methoxybenzaldehyde |
|---|---|
| PubChem CID | 60922402 |
| Molecular Formula | C10H10F2O3 |
| Molecular Weight | 216.18 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-5-methoxybenzaldehyde |
| SMILES | COc1ccc(OCC(F)F)c(C=O)c1 |
| InChI | InChI=1S/C10H10F2O3/c1-14-8-2-3-9(7(4-8)5-13)15-6-10(11)12/h2-5,10H,6H2,1H3 |
| InChIKey | ZZZNBHLNMLHNGM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|