About 5-(2,2-difluoroethylsulfanyl)-4-methyl-1,3-thiazol-2-amine
5-(2,2-difluoroethylsulfanyl)-4-methyl-1,3-thiazol-2-amine (PubChem CID 60922403) has the molecular formula C6H8F2N2S2
and a molecular weight of 210.27 g/mol. Its IUPAC name is 5-(2,2-difluoroethylsulfanyl)-4-methyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-(2,2-difluoroethylsulfanyl)-4-methyl-1,3-thiazol-2-amine |
| PubChem CID | 60922403 |
| Molecular Formula | C6H8F2N2S2 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 5-(2,2-difluoroethylsulfanyl)-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N)sc1SCC(F)F |
| InChI | InChI=1S/C6H8F2N2S2/c1-3-5(11-2-4(7)8)12-6(9)10-3/h4H,2H2,1H3,(H2,9,10) |
| InChIKey | MJQRGKFXVVHGRM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,2-difluoroethylsulfanyl)-4-methyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluoroethylsulfanyl)-4-methyl-1,3-thiazol-2-amine?
The IUPAC name of 5-(2,2-difluoroethylsulfanyl)-4-methyl-1,3-thiazol-2-amine (CID 60922403) is 5-(2,2-difluoroethylsulfanyl)-4-methyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-(2,2-difluoroethylsulfanyl)-4-methyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-(2,2-difluoroethylsulfanyl)-4-methyl-1,3-thiazol-2-amine is Cc1nc(N)sc1SCC(F)F.
What is the InChIKey of 5-(2,2-difluoroethylsulfanyl)-4-methyl-1,3-thiazol-2-amine?
The InChIKey is MJQRGKFXVVHGRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N2S2/c1-3-5(11-2-4(7)8)12-6(9)10-3/h4H,2H2,1H3,(H2,9,10).
What are the key properties of 5-(2,2-difluoroethylsulfanyl)-4-methyl-1,3-thiazol-2-amine?
5-(2,2-difluoroethylsulfanyl)-4-methyl-1,3-thiazol-2-amine has a molecular weight of 210.27 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethylsulfanyl)-4-methyl-1,3-thiazol-2-amine is sourced from PubChem (CID 60922403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).