C13H9F3N4O — CID 60922508
5-amino-2-[2-(trifluoromethoxy)anilino]pyridine-3-carbonitrile (PubChem CID 60922508) has the molecular formula C13H9F3N4O and a molecular weight of 294.24 g/mol. Its IUPAC name is 5-amino-2-[2-(trifluoromethoxy)anilino]pyridine-3-carbonitrile.
| Compound Name | 5-amino-2-[2-(trifluoromethoxy)anilino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 60922508 |
| Molecular Formula | C13H9F3N4O |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 5-amino-2-[2-(trifluoromethoxy)anilino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cc(N)cnc1Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H9F3N4O/c14-13(15,16)21-11-4-2-1-3-10(11)20-12-8(6-17)5-9(18)7-19-12/h1-5,7H,18H2,(H,19,20) |
| InChIKey | JBKGDKCQBUMZBI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |