C11H13ClF2O3S — CID 60922524
4-(2,2-difluoroethoxy)-3-propan-2-ylbenzenesulfonyl chloride (PubChem CID 60922524) has the molecular formula C11H13ClF2O3S and a molecular weight of 298.74 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-3-propan-2-ylbenzenesulfonyl chloride.
| Compound Name | 4-(2,2-difluoroethoxy)-3-propan-2-ylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 60922524 |
| Molecular Formula | C11H13ClF2O3S |
| Molecular Weight | 298.74 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-3-propan-2-ylbenzenesulfonyl chloride |
| SMILES | CC(C)c1cc(S(=O)(=O)Cl)ccc1OCC(F)F |
| InChI | InChI=1S/C11H13ClF2O3S/c1-7(2)9-5-8(18(12,15)16)3-4-10(9)17-6-11(13)14/h3-5,7,11H,6H2,1-2H3 |
| InChIKey | URSMTQMKKYWZOO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.74 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |