About N-(cyclobutylmethyl)-2,2-difluoroethanamine
N-(cyclobutylmethyl)-2,2-difluoroethanamine (PubChem CID 60922535) has the molecular formula C7H13F2N
and a molecular weight of 149.18 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | N-(cyclobutylmethyl)-2,2-difluoroethanamine |
| PubChem CID | 60922535 |
| Molecular Formula | C7H13F2N |
| Molecular Weight | 149.18 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | N-(cyclobutylmethyl)-2,2-difluoroethanamine |
| SMILES | FC(F)CNCC1CCC1 |
| InChI | InChI=1S/C7H13F2N/c8-7(9)5-10-4-6-2-1-3-6/h6-7,10H,1-5H2 |
| InChIKey | KPYZWBAPTXFEPM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(cyclobutylmethyl)-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclobutylmethyl)-2,2-difluoroethanamine?
The IUPAC name of N-(cyclobutylmethyl)-2,2-difluoroethanamine (CID 60922535) is N-(cyclobutylmethyl)-2,2-difluoroethanamine.
What is the SMILES notation for N-(cyclobutylmethyl)-2,2-difluoroethanamine?
The canonical SMILES for N-(cyclobutylmethyl)-2,2-difluoroethanamine is FC(F)CNCC1CCC1.
What is the InChIKey of N-(cyclobutylmethyl)-2,2-difluoroethanamine?
The InChIKey is KPYZWBAPTXFEPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F2N/c8-7(9)5-10-4-6-2-1-3-6/h6-7,10H,1-5H2.
What are the key properties of N-(cyclobutylmethyl)-2,2-difluoroethanamine?
N-(cyclobutylmethyl)-2,2-difluoroethanamine has a molecular weight of 149.18 g/mol, XLogP of 1.64, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclobutylmethyl)-2,2-difluoroethanamine is sourced from PubChem (CID 60922535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).