C11H12F2N2O — CID 60922791
6-amino-1-(2,2-difluoroethyl)-3,4-dihydroquinolin-2-one (PubChem CID 60922791) has the molecular formula C11H12F2N2O and a molecular weight of 226.23 g/mol. Its IUPAC name is 6-amino-1-(2,2-difluoroethyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 6-amino-1-(2,2-difluoroethyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 60922791 |
| Molecular Formula | C11H12F2N2O |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 6-amino-1-(2,2-difluoroethyl)-3,4-dihydroquinolin-2-one |
| SMILES | Nc1ccc2c(c1)CCC(=O)N2CC(F)F |
| InChI | InChI=1S/C11H12F2N2O/c12-10(13)6-15-9-3-2-8(14)5-7(9)1-4-11(15)16/h2-3,5,10H,1,4,6,14H2 |
| InChIKey | DAIDXOQCCJTAAG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|