C6H13F2NO — CID 60922929
2-(2,2-difluoroethylamino)butan-1-ol (PubChem CID 60922929) has the molecular formula C6H13F2NO and a molecular weight of 153.17 g/mol. Its IUPAC name is 2-(2,2-difluoroethylamino)butan-1-ol.
| Compound Name | 2-(2,2-difluoroethylamino)butan-1-ol |
|---|---|
| PubChem CID | 60922929 |
| Molecular Formula | C6H13F2NO |
| Molecular Weight | 153.17 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 2-(2,2-difluoroethylamino)butan-1-ol |
| SMILES | CCC(CO)NCC(F)F |
| InChI | InChI=1S/C6H13F2NO/c1-2-5(4-10)9-3-6(7)8/h5-6,9-10H,2-4H2,1H3 |
| InChIKey | AQMOSUMJYZLGJU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.17 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |