About 5-bromo-3-chloro-2-(2,2-difluoroethoxy)benzenesulfonamide
5-bromo-3-chloro-2-(2,2-difluoroethoxy)benzenesulfonamide (PubChem CID 60922947) has the molecular formula C8H7BrClF2NO3S
and a molecular weight of 350.57 g/mol. Its IUPAC name is 5-bromo-3-chloro-2-(2,2-difluoroethoxy)benzenesulfonamide.
Molecular Properties
| Compound Name | 5-bromo-3-chloro-2-(2,2-difluoroethoxy)benzenesulfonamide |
| PubChem CID | 60922947 |
| Molecular Formula | C8H7BrClF2NO3S |
| Molecular Weight | 350.57 g/mol |
| Exact Mass | 348.90 |
| IUPAC Name | 5-bromo-3-chloro-2-(2,2-difluoroethoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Br)cc(Cl)c1OCC(F)F |
| InChI | InChI=1S/C8H7BrClF2NO3S/c9-4-1-5(10)8(16-3-7(11)12)6(2-4)17(13,14)15/h1-2,7H,3H2,(H2,13,14,15) |
| InChIKey | VVSCJNBOHULGGU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-3-chloro-2-(2,2-difluoroethoxy)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-chloro-2-(2,2-difluoroethoxy)benzenesulfonamide?
The IUPAC name of 5-bromo-3-chloro-2-(2,2-difluoroethoxy)benzenesulfonamide (CID 60922947) is 5-bromo-3-chloro-2-(2,2-difluoroethoxy)benzenesulfonamide.
What is the SMILES notation for 5-bromo-3-chloro-2-(2,2-difluoroethoxy)benzenesulfonamide?
The canonical SMILES for 5-bromo-3-chloro-2-(2,2-difluoroethoxy)benzenesulfonamide is NS(=O)(=O)c1cc(Br)cc(Cl)c1OCC(F)F.
What is the InChIKey of 5-bromo-3-chloro-2-(2,2-difluoroethoxy)benzenesulfonamide?
The InChIKey is VVSCJNBOHULGGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrClF2NO3S/c9-4-1-5(10)8(16-3-7(11)12)6(2-4)17(13,14)15/h1-2,7H,3H2,(H2,13,14,15).
What are the key properties of 5-bromo-3-chloro-2-(2,2-difluoroethoxy)benzenesulfonamide?
5-bromo-3-chloro-2-(2,2-difluoroethoxy)benzenesulfonamide has a molecular weight of 350.57 g/mol, XLogP of 2.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-chloro-2-(2,2-difluoroethoxy)benzenesulfonamide is sourced from PubChem (CID 60922947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).