2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid

C7H11F2NO2 — CID 60922951

IUPAC2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid
SMILESO=C(O)CN(CC(F)F)C1CC1
InChIInChI=1S/C7H11F2NO2/c8-6(9)3-10(4-7(11)12)5-1-2-5/h5-6H,1-4H2,(H,11,12)
InChIKeyOGNIQXCIZNINSH-UHFFFAOYSA-N
MW179.17 g/mol
LogP0.80
Rot. Bonds5

About 2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid

2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid (PubChem CID 60922951) has the molecular formula C7H11F2NO2 and a molecular weight of 179.17 g/mol. Its IUPAC name is 2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid.

Molecular Properties

Compound Name2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid
PubChem CID60922951
Molecular FormulaC7H11F2NO2
Molecular Weight179.17 g/mol
Exact Mass179.08
IUPAC Name2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid
SMILESO=C(O)CN(CC(F)F)C1CC1
InChIInChI=1S/C7H11F2NO2/c8-6(9)3-10(4-7(11)12)5-1-2-5/h5-6H,1-4H2,(H,11,12)
InChIKeyOGNIQXCIZNINSH-UHFFFAOYSA-N
XLogP0.80
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.17
LogP ≤ 50.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid?
The IUPAC name of 2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid (CID 60922951) is 2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid.
What is the SMILES notation for 2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid?
The canonical SMILES for 2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid is O=C(O)CN(CC(F)F)C1CC1.
What is the InChIKey of 2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid?
The InChIKey is OGNIQXCIZNINSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2NO2/c8-6(9)3-10(4-7(11)12)5-1-2-5/h5-6H,1-4H2,(H,11,12).
What are the key properties of 2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid?
2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid has a molecular weight of 179.17 g/mol, XLogP of 0.80, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopropyl(2,2-difluoroethyl)amino]acetic acid is sourced from PubChem (CID 60922951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).