About 3-[2,2-difluoroethyl(methyl)amino]propanenitrile
3-[2,2-difluoroethyl(methyl)amino]propanenitrile (PubChem CID 60923077) has the molecular formula C6H10F2N2
and a molecular weight of 148.16 g/mol. Its IUPAC name is 3-[2,2-difluoroethyl(methyl)amino]propanenitrile.
Analyze 3-[2,2-difluoroethyl(methyl)amino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,2-difluoroethyl(methyl)amino]propanenitrile?
The IUPAC name of 3-[2,2-difluoroethyl(methyl)amino]propanenitrile (CID 60923077) is 3-[2,2-difluoroethyl(methyl)amino]propanenitrile.
What is the SMILES notation for 3-[2,2-difluoroethyl(methyl)amino]propanenitrile?
The canonical SMILES for 3-[2,2-difluoroethyl(methyl)amino]propanenitrile is CN(CCC#N)CC(F)F.
What is the InChIKey of 3-[2,2-difluoroethyl(methyl)amino]propanenitrile?
The InChIKey is FQSVLAHXWXHPMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F2N2/c1-10(4-2-3-9)5-6(7)8/h6H,2,4-5H2,1H3.
What are the key properties of 3-[2,2-difluoroethyl(methyl)amino]propanenitrile?
3-[2,2-difluoroethyl(methyl)amino]propanenitrile has a molecular weight of 148.16 g/mol, XLogP of 1.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,2-difluoroethyl(methyl)amino]propanenitrile is sourced from PubChem (CID 60923077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).