C15H20F3N3O3 — CID 609232
ethyl 2-(butanoylamino)-3,3,3-trifluoro-2-[(6-methyl-2-pyridinyl)amino]propanoate (PubChem CID 609232) has the molecular formula C15H20F3N3O3 and a molecular weight of 347.34 g/mol. Its IUPAC name is ethyl 2-(butanoylamino)-3,3,3-trifluoro-2-[(6-methyl-2-pyridinyl)amino]propanoate.
| Compound Name | ethyl 2-(butanoylamino)-3,3,3-trifluoro-2-[(6-methyl-2-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 609232 |
| Molecular Formula | C15H20F3N3O3 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | ethyl 2-(butanoylamino)-3,3,3-trifluoro-2-[(6-methyl-2-pyridinyl)amino]propanoate |
| SMILES | CCCC(=O)NC(Nc1cccc(C)n1)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C15H20F3N3O3/c1-4-7-12(22)21-14(15(16,17)18,13(23)24-5-2)20-11-9-6-8-10(3)19-11/h6,8-9H,4-5,7H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | GBUNNRREIZYKQK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|