About N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine
N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine (PubChem CID 60924156) has the molecular formula C14H25N5O2
and a molecular weight of 295.39 g/mol. Its IUPAC name is N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine.
Molecular Properties
| Compound Name | N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine |
| PubChem CID | 60924156 |
| Molecular Formula | C14H25N5O2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine |
| SMILES | COc1ncnc(OC)c1CNCCN1CCN(C)CC1 |
| InChI | InChI=1S/C14H25N5O2/c1-18-6-8-19(9-7-18)5-4-15-10-12-13(20-2)16-11-17-14(12)21-3/h11,15H,4-10H2,1-3H3 |
| InChIKey | KJULLVVUEMOZAL-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine?
The IUPAC name of N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine (CID 60924156) is N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine.
What is the SMILES notation for N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine?
The canonical SMILES for N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine is COc1ncnc(OC)c1CNCCN1CCN(C)CC1.
What is the InChIKey of N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine?
The InChIKey is KJULLVVUEMOZAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N5O2/c1-18-6-8-19(9-7-18)5-4-15-10-12-13(20-2)16-11-17-14(12)21-3/h11,15H,4-10H2,1-3H3.
What are the key properties of N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine?
N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine has a molecular weight of 295.39 g/mol, XLogP of -0.17, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine is sourced from PubChem (CID 60924156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).