C16H26FN3O — CID 60924375
1-(2-fluoro-4-methoxyphenyl)-N-[2-(4-methylpiperazin-1-yl)ethyl]ethanamine (PubChem CID 60924375) has the molecular formula C16H26FN3O and a molecular weight of 295.40 g/mol. Its IUPAC name is 1-(2-fluoro-4-methoxyphenyl)-N-[2-(4-methylpiperazin-1-yl)ethyl]ethanamine.
| Compound Name | 1-(2-fluoro-4-methoxyphenyl)-N-[2-(4-methylpiperazin-1-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 60924375 |
| Molecular Formula | C16H26FN3O |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 1-(2-fluoro-4-methoxyphenyl)-N-[2-(4-methylpiperazin-1-yl)ethyl]ethanamine |
| SMILES | COc1ccc(C(C)NCCN2CCN(C)CC2)c(F)c1 |
| InChI | InChI=1S/C16H26FN3O/c1-13(15-5-4-14(21-3)12-16(15)17)18-6-7-20-10-8-19(2)9-11-20/h4-5,12-13,18H,6-11H2,1-3H3 |
| InChIKey | ILFIEHPVIMAOMY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |