About 5-amino-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile
5-amino-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile (PubChem CID 60924910) has the molecular formula C9H8N6S
and a molecular weight of 232.27 g/mol. Its IUPAC name is 5-amino-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile |
| PubChem CID | 60924910 |
| Molecular Formula | C9H8N6S |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 5-amino-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile |
| SMILES | Cn1cnnc1Sc1ncc(N)cc1C#N |
| InChI | InChI=1S/C9H8N6S/c1-15-5-13-14-9(15)16-8-6(3-10)2-7(11)4-12-8/h2,4-5H,11H2,1H3 |
| InChIKey | BVLIQTJDQRQACB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-amino-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile?
The IUPAC name of 5-amino-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile (CID 60924910) is 5-amino-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile.
What is the SMILES notation for 5-amino-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile?
The canonical SMILES for 5-amino-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile is Cn1cnnc1Sc1ncc(N)cc1C#N.
What is the InChIKey of 5-amino-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile?
The InChIKey is BVLIQTJDQRQACB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N6S/c1-15-5-13-14-9(15)16-8-6(3-10)2-7(11)4-12-8/h2,4-5H,11H2,1H3.
What are the key properties of 5-amino-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile?
5-amino-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile has a molecular weight of 232.27 g/mol, XLogP of 0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile is sourced from PubChem (CID 60924910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).