C16H24N2O3 — CID 60925597
3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)-N,N-diethylpropanamide (PubChem CID 60925597) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)-N,N-diethylpropanamide.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 60925597 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H24N2O3/c1-3-18(4-2)16(19)7-8-17-12-13-5-6-14-15(11-13)21-10-9-20-14/h5-6,11,17H,3-4,7-10,12H2,1-2H3 |
| InChIKey | UNLGFQPOVWGZQA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|