About 3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide
3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide (PubChem CID 60925606) has the molecular formula C14H23N3O3
and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide |
| PubChem CID | 60925606 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNC1CC(=O)N(C2CC2)C1=O |
| InChI | InChI=1S/C14H23N3O3/c1-3-16(4-2)12(18)7-8-15-11-9-13(19)17(14(11)20)10-5-6-10/h10-11,15H,3-9H2,1-2H3 |
| InChIKey | SBUWWOYVGZSFKS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide?
The IUPAC name of 3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide (CID 60925606) is 3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide.
What is the SMILES notation for 3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide?
The canonical SMILES for 3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide is CCN(CC)C(=O)CCNC1CC(=O)N(C2CC2)C1=O.
What is the InChIKey of 3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide?
The InChIKey is SBUWWOYVGZSFKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O3/c1-3-16(4-2)12(18)7-8-15-11-9-13(19)17(14(11)20)10-5-6-10/h10-11,15H,3-9H2,1-2H3.
What are the key properties of 3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide?
3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide has a molecular weight of 281.36 g/mol, XLogP of 0.12, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide is sourced from PubChem (CID 60925606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).