About 4-chloro-[1]benzofuro[3,2-d]pyrimidine
4-chloro-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 609295) has the molecular formula C10H5ClN2O
and a molecular weight of 204.62 g/mol. Its IUPAC name is 4-chloro-[1]benzofuro[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 4-chloro-[1]benzofuro[3,2-d]pyrimidine |
| PubChem CID | 609295 |
| Molecular Formula | C10H5ClN2O |
| Molecular Weight | 204.62 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 4-chloro-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | Clc1ncnc2c1oc1ccccc12 |
| InChI | InChI=1S/C10H5ClN2O/c11-10-9-8(12-5-13-10)6-3-1-2-4-7(6)14-9/h1-5H |
| InChIKey | ABRHSRPOYMSBOI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.62 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-[1]benzofuro[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-[1]benzofuro[3,2-d]pyrimidine?
The IUPAC name of 4-chloro-[1]benzofuro[3,2-d]pyrimidine (CID 609295) is 4-chloro-[1]benzofuro[3,2-d]pyrimidine.
What is the SMILES notation for 4-chloro-[1]benzofuro[3,2-d]pyrimidine?
The canonical SMILES for 4-chloro-[1]benzofuro[3,2-d]pyrimidine is Clc1ncnc2c1oc1ccccc12.
What is the InChIKey of 4-chloro-[1]benzofuro[3,2-d]pyrimidine?
The InChIKey is ABRHSRPOYMSBOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5ClN2O/c11-10-9-8(12-5-13-10)6-3-1-2-4-7(6)14-9/h1-5H.
What are the key properties of 4-chloro-[1]benzofuro[3,2-d]pyrimidine?
4-chloro-[1]benzofuro[3,2-d]pyrimidine has a molecular weight of 204.62 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-[1]benzofuro[3,2-d]pyrimidine is sourced from PubChem (CID 609295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).