About thieno[3,2-b]thiophene-2,5-dithiol
thieno[3,2-b]thiophene-2,5-dithiol (PubChem CID 609297) has the molecular formula C6H4S4
and a molecular weight of 204.37 g/mol. Its IUPAC name is thieno[3,2-b]thiophene-2,5-dithiol.
Molecular Properties
| Compound Name | thieno[3,2-b]thiophene-2,5-dithiol |
| PubChem CID | 609297 |
| Molecular Formula | C6H4S4 |
| Molecular Weight | 204.37 g/mol |
| Exact Mass | 203.92 |
| IUPAC Name | thieno[3,2-b]thiophene-2,5-dithiol |
| SMILES | Sc1cc2sc(S)cc2s1 |
| InChI | InChI=1S/C6H4S4/c7-5-1-3-4(10-5)2-6(8)9-3/h1-2,7-8H |
| InChIKey | HBZRBRQKAKCIBF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze thieno[3,2-b]thiophene-2,5-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-b]thiophene-2,5-dithiol?
The IUPAC name of thieno[3,2-b]thiophene-2,5-dithiol (CID 609297) is thieno[3,2-b]thiophene-2,5-dithiol.
What is the SMILES notation for thieno[3,2-b]thiophene-2,5-dithiol?
The canonical SMILES for thieno[3,2-b]thiophene-2,5-dithiol is Sc1cc2sc(S)cc2s1.
What is the InChIKey of thieno[3,2-b]thiophene-2,5-dithiol?
The InChIKey is HBZRBRQKAKCIBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4S4/c7-5-1-3-4(10-5)2-6(8)9-3/h1-2,7-8H.
What are the key properties of thieno[3,2-b]thiophene-2,5-dithiol?
thieno[3,2-b]thiophene-2,5-dithiol has a molecular weight of 204.37 g/mol, XLogP of 3.54, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-b]thiophene-2,5-dithiol is sourced from PubChem (CID 609297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).