C15H15BrN2OS — CID 60931989
4-[(5-bromothiophen-2-yl)methylamino]-N-prop-2-enylbenzamide (PubChem CID 60931989) has the molecular formula C15H15BrN2OS and a molecular weight of 351.27 g/mol. Its IUPAC name is 4-[(5-bromothiophen-2-yl)methylamino]-N-prop-2-enylbenzamide.
| Compound Name | 4-[(5-bromothiophen-2-yl)methylamino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 60931989 |
| Molecular Formula | C15H15BrN2OS |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 4-[(5-bromothiophen-2-yl)methylamino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(NCc2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C15H15BrN2OS/c1-2-9-17-15(19)11-3-5-12(6-4-11)18-10-13-7-8-14(16)20-13/h2-8,18H,1,9-10H2,(H,17,19) |
| InChIKey | XOLSMDYFUMCYGY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|