C12H16ClNO5S — CID 60933027
4-[(5-chloro-2-ethoxyphenyl)sulfamoyl]butanoic acid (PubChem CID 60933027) has the molecular formula C12H16ClNO5S and a molecular weight of 321.78 g/mol. Its IUPAC name is 4-[(5-chloro-2-ethoxyphenyl)sulfamoyl]butanoic acid.
| Compound Name | 4-[(5-chloro-2-ethoxyphenyl)sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 60933027 |
| Molecular Formula | C12H16ClNO5S |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 4-[(5-chloro-2-ethoxyphenyl)sulfamoyl]butanoic acid |
| SMILES | CCOc1ccc(Cl)cc1NS(=O)(=O)CCCC(=O)O |
| InChI | InChI=1S/C12H16ClNO5S/c1-2-19-11-6-5-9(13)8-10(11)14-20(17,18)7-3-4-12(15)16/h5-6,8,14H,2-4,7H2,1H3,(H,15,16) |
| InChIKey | XUDAXEYWVASOKP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |