C14H13N3O3 — CID 60934102
1-methyl-3-[4-(1,3-oxazol-5-yl)anilino]pyrrolidine-2,5-dione (PubChem CID 60934102) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 1-methyl-3-[4-(1,3-oxazol-5-yl)anilino]pyrrolidine-2,5-dione.
| Compound Name | 1-methyl-3-[4-(1,3-oxazol-5-yl)anilino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 60934102 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-methyl-3-[4-(1,3-oxazol-5-yl)anilino]pyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(Nc2ccc(-c3cnco3)cc2)C1=O |
| InChI | InChI=1S/C14H13N3O3/c1-17-13(18)6-11(14(17)19)16-10-4-2-9(3-5-10)12-7-15-8-20-12/h2-5,7-8,11,16H,6H2,1H3 |
| InChIKey | XDRMGBHHDAIDGJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|