C14H23N3O3 — CID 60934113
1-ethyl-3-[(1-oxo-1-piperidin-1-ylpropan-2-yl)amino]pyrrolidine-2,5-dione (PubChem CID 60934113) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-ethyl-3-[(1-oxo-1-piperidin-1-ylpropan-2-yl)amino]pyrrolidine-2,5-dione.
| Compound Name | 1-ethyl-3-[(1-oxo-1-piperidin-1-ylpropan-2-yl)amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 60934113 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-ethyl-3-[(1-oxo-1-piperidin-1-ylpropan-2-yl)amino]pyrrolidine-2,5-dione |
| SMILES | CCN1C(=O)CC(NC(C)C(=O)N2CCCCC2)C1=O |
| InChI | InChI=1S/C14H23N3O3/c1-3-17-12(18)9-11(14(17)20)15-10(2)13(19)16-7-5-4-6-8-16/h10-11,15H,3-9H2,1-2H3 |
| InChIKey | INNPATJKIFRIEE-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|