C15H17BrN2O2 — CID 60934971
4-[(5-bromofuran-2-yl)methylamino]-N-propan-2-ylbenzamide (PubChem CID 60934971) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is 4-[(5-bromofuran-2-yl)methylamino]-N-propan-2-ylbenzamide.
| Compound Name | 4-[(5-bromofuran-2-yl)methylamino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 60934971 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 4-[(5-bromofuran-2-yl)methylamino]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(NCc2ccc(Br)o2)cc1 |
| InChI | InChI=1S/C15H17BrN2O2/c1-10(2)18-15(19)11-3-5-12(6-4-11)17-9-13-7-8-14(16)20-13/h3-8,10,17H,9H2,1-2H3,(H,18,19) |
| InChIKey | NCZDAAGMCUNSBL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |