C17H28N2O2 — CID 60936867
3-(tert-butylamino)-N-[(4-ethoxyphenyl)methyl]-N-methylpropanamide (PubChem CID 60936867) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 3-(tert-butylamino)-N-[(4-ethoxyphenyl)methyl]-N-methylpropanamide.
| Compound Name | 3-(tert-butylamino)-N-[(4-ethoxyphenyl)methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 60936867 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 3-(tert-butylamino)-N-[(4-ethoxyphenyl)methyl]-N-methylpropanamide |
| SMILES | CCOc1ccc(CN(C)C(=O)CCNC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H28N2O2/c1-6-21-15-9-7-14(8-10-15)13-19(5)16(20)11-12-18-17(2,3)4/h7-10,18H,6,11-13H2,1-5H3 |
| InChIKey | CLSJSAMZGKPCDE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |