About 1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one
1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one (PubChem CID 609380) has the molecular formula C11H15N3O
and a molecular weight of 205.26 g/mol. Its IUPAC name is 1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one.
Analyze 1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one?
The IUPAC name of 1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one (CID 609380) is 1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one.
What is the SMILES notation for 1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one?
The canonical SMILES for 1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one is O=c1c2c(nc3n1CCCC3)CCNC2.
What is the InChIKey of 1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one?
The InChIKey is GJHQXUKKTIIPOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O/c15-11-8-7-12-5-4-9(8)13-10-3-1-2-6-14(10)11/h12H,1-7H2.
What are the key properties of 1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one?
1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one has a molecular weight of 205.26 g/mol, XLogP of 0.23, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one is sourced from PubChem (CID 609380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).