2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid

C13H14N4O3 — CID 60941368

IUPAC2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid
SMILESCC(NC(=O)c1ccccc1C(=O)O)c1nncn1C
InChIInChI=1S/C13H14N4O3/c1-8(11-16-14-7-17(11)2)15-12(18)9-5-3-4-6-10(9)13(19)20/h3-8H,1-2H3,(H,15,18)(H,19,20)
InChIKeyBKJZBRZBPIZBLX-UHFFFAOYSA-N
MW274.28 g/mol
LogP1.00
Rot. Bonds4

About 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid

2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid (PubChem CID 60941368) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid.

Molecular Properties

Compound Name2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid
PubChem CID60941368
Molecular FormulaC13H14N4O3
Molecular Weight274.28 g/mol
Exact Mass274.11
IUPAC Name2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid
SMILESCC(NC(=O)c1ccccc1C(=O)O)c1nncn1C
InChIInChI=1S/C13H14N4O3/c1-8(11-16-14-7-17(11)2)15-12(18)9-5-3-4-6-10(9)13(19)20/h3-8H,1-2H3,(H,15,18)(H,19,20)
InChIKeyBKJZBRZBPIZBLX-UHFFFAOYSA-N
XLogP1.00
TPSA97.11 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.28
LogP ≤ 51.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid?
The IUPAC name of 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid (CID 60941368) is 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid.
What is the SMILES notation for 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid?
The canonical SMILES for 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid is CC(NC(=O)c1ccccc1C(=O)O)c1nncn1C.
What is the InChIKey of 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid?
The InChIKey is BKJZBRZBPIZBLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O3/c1-8(11-16-14-7-17(11)2)15-12(18)9-5-3-4-6-10(9)13(19)20/h3-8H,1-2H3,(H,15,18)(H,19,20).
What are the key properties of 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid?
2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid has a molecular weight of 274.28 g/mol, XLogP of 1.00, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]benzoic acid is sourced from PubChem (CID 60941368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).