C11H10F2N2S — CID 60941776
2,6-difluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]aniline (PubChem CID 60941776) has the molecular formula C11H10F2N2S and a molecular weight of 240.28 g/mol. Its IUPAC name is 2,6-difluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]aniline.
| Compound Name | 2,6-difluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 60941776 |
| Molecular Formula | C11H10F2N2S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2,6-difluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]aniline |
| SMILES | Cc1ncc(CNc2c(F)cccc2F)s1 |
| InChI | InChI=1S/C11H10F2N2S/c1-7-14-5-8(16-7)6-15-11-9(12)3-2-4-10(11)13/h2-5,15H,6H2,1H3 |
| InChIKey | JBNYWZDXLLOMMJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |