C19H22N2 — CID 60942193
N-(3-pyrrolidin-1-ylphenyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 60942193) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-(3-pyrrolidin-1-ylphenyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-(3-pyrrolidin-1-ylphenyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 60942193 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N-(3-pyrrolidin-1-ylphenyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | c1cc(NC2Cc3ccccc3C2)cc(N2CCCC2)c1 |
| InChI | InChI=1S/C19H22N2/c1-2-7-16-13-18(12-15(16)6-1)20-17-8-5-9-19(14-17)21-10-3-4-11-21/h1-2,5-9,14,18,20H,3-4,10-13H2 |
| InChIKey | VYJGDFXAGDOWBX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |