C16H24N4O — CID 60943379
N-(4-methoxy-4-methylpentan-2-yl)-2-(2-methylimidazol-1-yl)pyridin-3-amine (PubChem CID 60943379) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is N-(4-methoxy-4-methylpentan-2-yl)-2-(2-methylimidazol-1-yl)pyridin-3-amine.
| Compound Name | N-(4-methoxy-4-methylpentan-2-yl)-2-(2-methylimidazol-1-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 60943379 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N-(4-methoxy-4-methylpentan-2-yl)-2-(2-methylimidazol-1-yl)pyridin-3-amine |
| SMILES | COC(C)(C)CC(C)Nc1cccnc1-n1ccnc1C |
| InChI | InChI=1S/C16H24N4O/c1-12(11-16(3,4)21-5)19-14-7-6-8-18-15(14)20-10-9-17-13(20)2/h6-10,12,19H,11H2,1-5H3 |
| InChIKey | RFSOTCCSPGZYBB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |