C17H17ClN2O — CID 60943994
4-[3-[(2-chlorophenyl)methylamino]phenoxy]butanenitrile (PubChem CID 60943994) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is 4-[3-[(2-chlorophenyl)methylamino]phenoxy]butanenitrile.
| Compound Name | 4-[3-[(2-chlorophenyl)methylamino]phenoxy]butanenitrile |
|---|---|
| PubChem CID | 60943994 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 4-[3-[(2-chlorophenyl)methylamino]phenoxy]butanenitrile |
| SMILES | N#CCCCOc1cccc(NCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C17H17ClN2O/c18-17-9-2-1-6-14(17)13-20-15-7-5-8-16(12-15)21-11-4-3-10-19/h1-2,5-9,12,20H,3-4,11,13H2 |
| InChIKey | SIJMTICNHINLDV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|