C17H18F3N — CID 60944396
1-(4-methylphenyl)-N-[[2-(trifluoromethyl)phenyl]methyl]ethanamine (PubChem CID 60944396) has the molecular formula C17H18F3N and a molecular weight of 293.33 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-[[2-(trifluoromethyl)phenyl]methyl]ethanamine.
| Compound Name | 1-(4-methylphenyl)-N-[[2-(trifluoromethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 60944396 |
| Molecular Formula | C17H18F3N |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-(4-methylphenyl)-N-[[2-(trifluoromethyl)phenyl]methyl]ethanamine |
| SMILES | Cc1ccc(C(C)NCc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H18F3N/c1-12-7-9-14(10-8-12)13(2)21-11-15-5-3-4-6-16(15)17(18,19)20/h3-10,13,21H,11H2,1-2H3 |
| InChIKey | XJHRMAPUKGKWIR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |