C14H21N3O3 — CID 60945232
2-amino-N,3-dimethyl-N-[(2-nitrophenyl)methyl]pentanamide (PubChem CID 60945232) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-amino-N,3-dimethyl-N-[(2-nitrophenyl)methyl]pentanamide.
| Compound Name | 2-amino-N,3-dimethyl-N-[(2-nitrophenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 60945232 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-amino-N,3-dimethyl-N-[(2-nitrophenyl)methyl]pentanamide |
| SMILES | CCC(C)C(N)C(=O)N(C)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21N3O3/c1-4-10(2)13(15)14(18)16(3)9-11-7-5-6-8-12(11)17(19)20/h5-8,10,13H,4,9,15H2,1-3H3 |
| InChIKey | LXRLTPBMAIVMPE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|