About 3-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide
3-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 60946145) has the molecular formula C10H19F3N2O
and a molecular weight of 240.27 g/mol. Its IUPAC name is 3-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide.
Molecular Properties
| Compound Name | 3-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide |
| PubChem CID | 60946145 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)CC(C)N |
| InChI | InChI=1S/C10H19F3N2O/c1-3-4-5-15(7-10(11,12)13)9(16)6-8(2)14/h8H,3-7,14H2,1-2H3 |
| InChIKey | WWUMYDSVNZSHSQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide?
The IUPAC name of 3-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide (CID 60946145) is 3-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide.
What is the SMILES notation for 3-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide?
The canonical SMILES for 3-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide is CCCCN(CC(F)(F)F)C(=O)CC(C)N.
What is the InChIKey of 3-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide?
The InChIKey is WWUMYDSVNZSHSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2O/c1-3-4-5-15(7-10(11,12)13)9(16)6-8(2)14/h8H,3-7,14H2,1-2H3.
What are the key properties of 3-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide?
3-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide has a molecular weight of 240.27 g/mol, XLogP of 1.91, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide is sourced from PubChem (CID 60946145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).