C11H20N2O2 — CID 60947366
1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-3-aminopropan-1-one (PubChem CID 60947366) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-3-aminopropan-1-one.
| Compound Name | 1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-3-aminopropan-1-one |
|---|---|
| PubChem CID | 60947366 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-3-aminopropan-1-one |
| SMILES | NCCC(=O)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C11H20N2O2/c12-6-5-11(14)13-7-8-15-10-4-2-1-3-9(10)13/h9-10H,1-8,12H2 |
| InChIKey | OWYXHSINLPGTGQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |