C9H15ClF3NO — CID 60948268
2-chloro-N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 60948268) has the molecular formula C9H15ClF3NO and a molecular weight of 245.67 g/mol. Its IUPAC name is 2-chloro-N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-chloro-N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 60948268 |
| Molecular Formula | C9H15ClF3NO |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2-chloro-N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(C)CN(CC(F)(F)F)C(=O)C(C)Cl |
| InChI | InChI=1S/C9H15ClF3NO/c1-6(2)4-14(5-9(11,12)13)8(15)7(3)10/h6-7H,4-5H2,1-3H3 |
| InChIKey | WWWZGPRRDPIFBQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|