C13H15ClF3NO — CID 60948271
3-(chloromethyl)-N-propan-2-yl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 60948271) has the molecular formula C13H15ClF3NO and a molecular weight of 293.72 g/mol. Its IUPAC name is 3-(chloromethyl)-N-propan-2-yl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-(chloromethyl)-N-propan-2-yl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 60948271 |
| Molecular Formula | C13H15ClF3NO |
| Molecular Weight | 293.72 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-(chloromethyl)-N-propan-2-yl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CC(C)N(CC(F)(F)F)C(=O)c1cccc(CCl)c1 |
| InChI | InChI=1S/C13H15ClF3NO/c1-9(2)18(8-13(15,16)17)12(19)11-5-3-4-10(6-11)7-14/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | PBFAXNFGBVPPOB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.72 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|