C13H24BrNO — CID 60949131
2-bromo-N,3-dimethyl-N-(2-methylcyclohexyl)butanamide (PubChem CID 60949131) has the molecular formula C13H24BrNO and a molecular weight of 290.25 g/mol. Its IUPAC name is 2-bromo-N,3-dimethyl-N-(2-methylcyclohexyl)butanamide.
| Compound Name | 2-bromo-N,3-dimethyl-N-(2-methylcyclohexyl)butanamide |
|---|---|
| PubChem CID | 60949131 |
| Molecular Formula | C13H24BrNO |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-bromo-N,3-dimethyl-N-(2-methylcyclohexyl)butanamide |
| SMILES | CC(C)C(Br)C(=O)N(C)C1CCCCC1C |
| InChI | InChI=1S/C13H24BrNO/c1-9(2)12(14)13(16)15(4)11-8-6-5-7-10(11)3/h9-12H,5-8H2,1-4H3 |
| InChIKey | DYXHTYPCOIVRFT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|