About 6-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-6-oxohexanoic acid
6-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-6-oxohexanoic acid (PubChem CID 60949828) has the molecular formula C13H22F3NO4
and a molecular weight of 313.32 g/mol. Its IUPAC name is 6-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-6-oxohexanoic acid.
Molecular Properties
| Compound Name | 6-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-6-oxohexanoic acid |
| PubChem CID | 60949828 |
| Molecular Formula | C13H22F3NO4 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 6-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-6-oxohexanoic acid |
| SMILES | CCOCCCN(CC(F)(F)F)C(=O)CCCCC(=O)O |
| InChI | InChI=1S/C13H22F3NO4/c1-2-21-9-5-8-17(10-13(14,15)16)11(18)6-3-4-7-12(19)20/h2-10H2,1H3,(H,19,20) |
| InChIKey | QSAQISAOHNJZJM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-6-oxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-6-oxohexanoic acid?
The IUPAC name of 6-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-6-oxohexanoic acid (CID 60949828) is 6-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-6-oxohexanoic acid.
What is the SMILES notation for 6-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-6-oxohexanoic acid?
The canonical SMILES for 6-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-6-oxohexanoic acid is CCOCCCN(CC(F)(F)F)C(=O)CCCCC(=O)O.
What is the InChIKey of 6-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-6-oxohexanoic acid?
The InChIKey is QSAQISAOHNJZJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F3NO4/c1-2-21-9-5-8-17(10-13(14,15)16)11(18)6-3-4-7-12(19)20/h2-10H2,1H3,(H,19,20).
What are the key properties of 6-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-6-oxohexanoic acid?
6-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-6-oxohexanoic acid has a molecular weight of 313.32 g/mol, XLogP of 2.45, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-6-oxohexanoic acid is sourced from PubChem (CID 60949828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).