C14H20F3NO3 — CID 60949932
6-[butyl(2,2,2-trifluoroethyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 60949932) has the molecular formula C14H20F3NO3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 6-[butyl(2,2,2-trifluoroethyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[butyl(2,2,2-trifluoroethyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 60949932 |
| Molecular Formula | C14H20F3NO3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 6-[butyl(2,2,2-trifluoroethyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCCCN(CC(F)(F)F)C(=O)C1CC=CCC1C(=O)O |
| InChI | InChI=1S/C14H20F3NO3/c1-2-3-8-18(9-14(15,16)17)12(19)10-6-4-5-7-11(10)13(20)21/h4-5,10-11H,2-3,6-9H2,1H3,(H,20,21) |
| InChIKey | KFYGNCFEXMVALS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|