2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid

C6H10F3NO5S — CID 60950149

IUPAC2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid
SMILESO=C(O)CS(=O)(=O)N(CCO)CC(F)(F)F
InChIInChI=1S/C6H10F3NO5S/c7-6(8,9)4-10(1-2-11)16(14,15)3-5(12)13/h11H,1-4H2,(H,12,13)
InChIKeyDOUZNCHGLRSCQF-UHFFFAOYSA-N
MW265.21 g/mol
LogP-0.74
Rot. Bonds6

About 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid

2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid (PubChem CID 60950149) has the molecular formula C6H10F3NO5S and a molecular weight of 265.21 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid.

Molecular Properties

Compound Name2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid
PubChem CID60950149
Molecular FormulaC6H10F3NO5S
Molecular Weight265.21 g/mol
Exact Mass265.02
IUPAC Name2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid
SMILESO=C(O)CS(=O)(=O)N(CCO)CC(F)(F)F
InChIInChI=1S/C6H10F3NO5S/c7-6(8,9)4-10(1-2-11)16(14,15)3-5(12)13/h11H,1-4H2,(H,12,13)
InChIKeyDOUZNCHGLRSCQF-UHFFFAOYSA-N
XLogP-0.74
TPSA94.91 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.21
LogP ≤ 5-0.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid?
The IUPAC name of 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid (CID 60950149) is 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid.
What is the SMILES notation for 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid?
The canonical SMILES for 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid is O=C(O)CS(=O)(=O)N(CCO)CC(F)(F)F.
What is the InChIKey of 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid?
The InChIKey is DOUZNCHGLRSCQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F3NO5S/c7-6(8,9)4-10(1-2-11)16(14,15)3-5(12)13/h11H,1-4H2,(H,12,13).
What are the key properties of 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid?
2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid has a molecular weight of 265.21 g/mol, XLogP of -0.74, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]acetic acid is sourced from PubChem (CID 60950149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).