About 5-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]furan-2-carboxylic acid
5-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]furan-2-carboxylic acid (PubChem CID 60951037) has the molecular formula C11H12N2O5S2
and a molecular weight of 316.36 g/mol. Its IUPAC name is 5-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]furan-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]furan-2-carboxylic acid |
| PubChem CID | 60951037 |
| Molecular Formula | C11H12N2O5S2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 5-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]furan-2-carboxylic acid |
| SMILES | Cc1ncc(CN(C)S(=O)(=O)c2ccc(C(=O)O)o2)s1 |
| InChI | InChI=1S/C11H12N2O5S2/c1-7-12-5-8(19-7)6-13(2)20(16,17)10-4-3-9(18-10)11(14)15/h3-5H,6H2,1-2H3,(H,14,15) |
| InChIKey | JGAWSHGRXLSQCD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]furan-2-carboxylic acid?
The IUPAC name of 5-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]furan-2-carboxylic acid (CID 60951037) is 5-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]furan-2-carboxylic acid.
What is the SMILES notation for 5-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]furan-2-carboxylic acid?
The canonical SMILES for 5-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]furan-2-carboxylic acid is Cc1ncc(CN(C)S(=O)(=O)c2ccc(C(=O)O)o2)s1.
What is the InChIKey of 5-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]furan-2-carboxylic acid?
The InChIKey is JGAWSHGRXLSQCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O5S2/c1-7-12-5-8(19-7)6-13(2)20(16,17)10-4-3-9(18-10)11(14)15/h3-5H,6H2,1-2H3,(H,14,15).
What are the key properties of 5-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]furan-2-carboxylic acid?
5-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]furan-2-carboxylic acid has a molecular weight of 316.36 g/mol, XLogP of 1.56, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]furan-2-carboxylic acid is sourced from PubChem (CID 60951037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).