About 2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]acetic acid
2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]acetic acid (PubChem CID 60951190) has the molecular formula C8H12N2O4S2
and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]acetic acid.
Molecular Properties
| Compound Name | 2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]acetic acid |
| PubChem CID | 60951190 |
| Molecular Formula | C8H12N2O4S2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]acetic acid |
| SMILES | Cc1ncc(CN(C)S(=O)(=O)CC(=O)O)s1 |
| InChI | InChI=1S/C8H12N2O4S2/c1-6-9-3-7(15-6)4-10(2)16(13,14)5-8(11)12/h3H,4-5H2,1-2H3,(H,11,12) |
| InChIKey | ASMDUOFHUZNLPM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]acetic acid?
The IUPAC name of 2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]acetic acid (CID 60951190) is 2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]acetic acid.
What is the SMILES notation for 2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]acetic acid?
The canonical SMILES for 2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]acetic acid is Cc1ncc(CN(C)S(=O)(=O)CC(=O)O)s1.
What is the InChIKey of 2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]acetic acid?
The InChIKey is ASMDUOFHUZNLPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4S2/c1-6-9-3-7(15-6)4-10(2)16(13,14)5-8(11)12/h3H,4-5H2,1-2H3,(H,11,12).
What are the key properties of 2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]acetic acid?
2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]acetic acid has a molecular weight of 264.33 g/mol, XLogP of 0.30, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]sulfamoyl]acetic acid is sourced from PubChem (CID 60951190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).