C13H15NO3 — CID 609514
5,5-dimethylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one (PubChem CID 609514) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 5,5-dimethylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one.
| Compound Name | 5,5-dimethylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 609514 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 5,5-dimethylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one |
| SMILES | CC1(C)COC2(OC1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C13H15NO3/c1-12(2)7-16-13(17-8-12)9-5-3-4-6-10(9)14-11(13)15/h3-6H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | JOPZGFLVJQSJLC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |