About 2-(cyclopentylamino)-N,N-bis(2-hydroxyethyl)acetamide
2-(cyclopentylamino)-N,N-bis(2-hydroxyethyl)acetamide (PubChem CID 60953471) has the molecular formula C11H22N2O3
and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-(cyclopentylamino)-N,N-bis(2-hydroxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-(cyclopentylamino)-N,N-bis(2-hydroxyethyl)acetamide |
| PubChem CID | 60953471 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 2-(cyclopentylamino)-N,N-bis(2-hydroxyethyl)acetamide |
| SMILES | O=C(CNC1CCCC1)N(CCO)CCO |
| InChI | InChI=1S/C11H22N2O3/c14-7-5-13(6-8-15)11(16)9-12-10-3-1-2-4-10/h10,12,14-15H,1-9H2 |
| InChIKey | YCXGVYXSEPUJDL-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(cyclopentylamino)-N,N-bis(2-hydroxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopentylamino)-N,N-bis(2-hydroxyethyl)acetamide?
The IUPAC name of 2-(cyclopentylamino)-N,N-bis(2-hydroxyethyl)acetamide (CID 60953471) is 2-(cyclopentylamino)-N,N-bis(2-hydroxyethyl)acetamide.
What is the SMILES notation for 2-(cyclopentylamino)-N,N-bis(2-hydroxyethyl)acetamide?
The canonical SMILES for 2-(cyclopentylamino)-N,N-bis(2-hydroxyethyl)acetamide is O=C(CNC1CCCC1)N(CCO)CCO.
What is the InChIKey of 2-(cyclopentylamino)-N,N-bis(2-hydroxyethyl)acetamide?
The InChIKey is YCXGVYXSEPUJDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3/c14-7-5-13(6-8-15)11(16)9-12-10-3-1-2-4-10/h10,12,14-15H,1-9H2.
What are the key properties of 2-(cyclopentylamino)-N,N-bis(2-hydroxyethyl)acetamide?
2-(cyclopentylamino)-N,N-bis(2-hydroxyethyl)acetamide has a molecular weight of 230.31 g/mol, XLogP of -0.67, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopentylamino)-N,N-bis(2-hydroxyethyl)acetamide is sourced from PubChem (CID 60953471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).